About (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate
(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate (PubChem CID 54421327) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate.
Molecular Properties
| Compound Name | (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate |
| PubChem CID | 54421327 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate |
| SMILES | CN1C2CCCC1CC(OC(=O)c1cnc3ccccc3c1)C2 |
| InChI | InChI=1S/C19H22N2O2/c1-21-15-6-4-7-16(21)11-17(10-15)23-19(22)14-9-13-5-2-3-8-18(13)20-12-14/h2-3,5,8-9,12,15-17H,4,6-7,10-11H2,1H3 |
| InChIKey | WAZSDKDOOAUVAD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate?
The IUPAC name of (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate (CID 54421327) is (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate.
What is the SMILES notation for (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate?
The canonical SMILES for (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate is CN1C2CCCC1CC(OC(=O)c1cnc3ccccc3c1)C2.
What is the InChIKey of (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate?
The InChIKey is WAZSDKDOOAUVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-21-15-6-4-7-16(21)11-17(10-15)23-19(22)14-9-13-5-2-3-8-18(13)20-12-14/h2-3,5,8-9,12,15-17H,4,6-7,10-11H2,1H3.
What are the key properties of (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate?
(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate has a molecular weight of 310.40 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) quinoline-3-carboxylate is sourced from PubChem (CID 54421327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).