C45H48N2O3Si — CID 54421594
(4R)-4-[[(1R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-1-ol (PubChem CID 54421594) has the molecular formula C45H48N2O3Si and a molecular weight of 692.98 g/mol. Its IUPAC name is (4R)-4-[[(1R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-1-ol.
| Compound Name | (4R)-4-[[(1R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 54421594 |
| Molecular Formula | C45H48N2O3Si |
| Molecular Weight | 692.98 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | (4R)-4-[[(1R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-1-ol |
| SMILES | CC(C)(C)[Si](Oc1cccc2c1CCC[C@H]2N[C@H](CCCO)c1nc(-c2ccccc2)c(-c2ccccc2)o1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H48N2O3Si/c1-45(2,3)51(35-23-12-6-13-24-35,36-25-14-7-15-26-36)50-41-31-17-27-37-38(41)28-16-29-39(37)46-40(30-18-32-48)44-47-42(33-19-8-4-9-20-33)43(49-44)34-21-10-5-11-22-34/h4-15,17,19-27,31,39-40,46,48H,16,18,28-30,32H2,1-3H3/t39-,40-/m1/s1 |
| InChIKey | WBEZZJRRGQTFLI-XRSDMRJBSA-N |
| XLogP | 9.43 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.98 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|