About hexa-2,5-dienoyl chloride
hexa-2,5-dienoyl chloride (PubChem CID 54421596) has the molecular formula C6H7ClO
and a molecular weight of 130.57 g/mol. Its IUPAC name is hexa-2,5-dienoyl chloride.
Molecular Properties
| Compound Name | hexa-2,5-dienoyl chloride |
| PubChem CID | 54421596 |
| Molecular Formula | C6H7ClO |
| Molecular Weight | 130.57 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | hexa-2,5-dienoyl chloride |
| SMILES | C=CCC=CC(=O)Cl |
| InChI | InChI=1S/C6H7ClO/c1-2-3-4-5-6(7)8/h2,4-5H,1,3H2 |
| InChIKey | WBFAQBYAUNKLBC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexa-2,5-dienoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-2,5-dienoyl chloride?
The IUPAC name of hexa-2,5-dienoyl chloride (CID 54421596) is hexa-2,5-dienoyl chloride.
What is the SMILES notation for hexa-2,5-dienoyl chloride?
The canonical SMILES for hexa-2,5-dienoyl chloride is C=CCC=CC(=O)Cl.
What is the InChIKey of hexa-2,5-dienoyl chloride?
The InChIKey is WBFAQBYAUNKLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO/c1-2-3-4-5-6(7)8/h2,4-5H,1,3H2.
What are the key properties of hexa-2,5-dienoyl chloride?
hexa-2,5-dienoyl chloride has a molecular weight of 130.57 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-2,5-dienoyl chloride is sourced from PubChem (CID 54421596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).