C7H6F3NO4 — CID 54421767
2,2,2-trifluoro-N-[(3S)-4-methyl-2,5-dioxooxolan-3-yl]acetamide (PubChem CID 54421767) has the molecular formula C7H6F3NO4 and a molecular weight of 225.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S)-4-methyl-2,5-dioxooxolan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S)-4-methyl-2,5-dioxooxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 54421767 |
| Molecular Formula | C7H6F3NO4 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S)-4-methyl-2,5-dioxooxolan-3-yl]acetamide |
| SMILES | CC1C(=O)OC(=O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H6F3NO4/c1-2-3(5(13)15-4(2)12)11-6(14)7(8,9)10/h2-3H,1H3,(H,11,14)/t2?,3-/m0/s1 |
| InChIKey | WBHYJFORNZDYCL-NFJMKROFSA-N |
| XLogP | -0.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|