C38H76NO2+ — CID 54421860
bis[(12R)-12-hydroxyoctadec-9-enyl]-dimethylazanium (PubChem CID 54421860) has the molecular formula C38H76NO2+ and a molecular weight of 579.03 g/mol. Its IUPAC name is bis[(12R)-12-hydroxyoctadec-9-enyl]-dimethylazanium.
| Compound Name | bis[(12R)-12-hydroxyoctadec-9-enyl]-dimethylazanium |
|---|---|
| PubChem CID | 54421860 |
| Molecular Formula | C38H76NO2+ |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.59 |
| IUPAC Name | bis[(12R)-12-hydroxyoctadec-9-enyl]-dimethylazanium |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC[N+](C)(C)CCCCCCCCC=CC[C@H](O)CCCCCC |
| InChI | InChI=1S/C38H76NO2/c1-5-7-9-25-31-37(40)33-27-21-17-13-11-15-19-23-29-35-39(3,4)36-30-24-20-16-12-14-18-22-28-34-38(41)32-26-10-8-6-2/h21-22,27-28,37-38,40-41H,5-20,23-26,29-36H2,1-4H3/q+1/t37-,38-/m1/s1 |
| InChIKey | WBJMQVVWBZFOOX-XPSQVAKYSA-N |
| XLogP | 11.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|