C19H25N3O8S — CID 54422491
2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-7-(2-acetyloxypropan-2-yl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54422491) has the molecular formula C19H25N3O8S and a molecular weight of 455.49 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-7-(2-acetyloxypropan-2-yl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-7-(2-acetyloxypropan-2-yl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54422491 |
| Molecular Formula | C19H25N3O8S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (5R,6S,7S)-7-(2-acetyloxypropan-2-yl)-4-diazo-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(C)(C)[C@H]1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)=C(C)C(=[N+]=[N-])[S@](=O)[C@@H]12 |
| InChI | InChI=1S/C19H25N3O8S/c1-9-12(16(25)28-8-29-17(26)18(3,4)5)22-14(24)11(19(6,7)30-10(2)23)15(22)31(27)13(9)21-20/h11,15H,8H2,1-7H3/t11-,15-,31-/m0/s1 |
| InChIKey | WBUBSXBLNWPAMI-OMDZGXMTSA-N |
| XLogP | 0.87 |
| TPSA | 152.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|