About 1-methoxypyrrolidine-2,5-dione
1-methoxypyrrolidine-2,5-dione (PubChem CID 544225) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is 1-methoxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-methoxypyrrolidine-2,5-dione |
| PubChem CID | 544225 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 1-methoxypyrrolidine-2,5-dione |
| SMILES | CON1C(=O)CCC1=O |
| InChI | InChI=1S/C5H7NO3/c1-9-6-4(7)2-3-5(6)8/h2-3H2,1H3 |
| InChIKey | JDFXJJLFADUZIY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypyrrolidine-2,5-dione?
The IUPAC name of 1-methoxypyrrolidine-2,5-dione (CID 544225) is 1-methoxypyrrolidine-2,5-dione.
What is the SMILES notation for 1-methoxypyrrolidine-2,5-dione?
The canonical SMILES for 1-methoxypyrrolidine-2,5-dione is CON1C(=O)CCC1=O.
What is the InChIKey of 1-methoxypyrrolidine-2,5-dione?
The InChIKey is JDFXJJLFADUZIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c1-9-6-4(7)2-3-5(6)8/h2-3H2,1H3.
What are the key properties of 1-methoxypyrrolidine-2,5-dione?
1-methoxypyrrolidine-2,5-dione has a molecular weight of 129.11 g/mol, XLogP of -0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypyrrolidine-2,5-dione is sourced from PubChem (CID 544225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).