C37H34F6N4O5 — CID 54422868
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[[3-(2,2,2-trifluoro-1-nitrosoethyl)phenyl]methyl]-1,3-diazepan-2-one (PubChem CID 54422868) has the molecular formula C37H34F6N4O5 and a molecular weight of 728.69 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[[3-(2,2,2-trifluoro-1-nitrosoethyl)phenyl]methyl]-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[[3-(2,2,2-trifluoro-1-nitrosoethyl)phenyl]methyl]-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 54422868 |
| Molecular Formula | C37H34F6N4O5 |
| Molecular Weight | 728.69 g/mol |
| Exact Mass | 728.24 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[[3-(2,2,2-trifluoro-1-nitrosoethyl)phenyl]methyl]-1,3-diazepan-2-one |
| SMILES | O=NC(c1cccc(CN2C(=O)N(Cc3cccc(C(N=O)C(F)(F)F)c3)[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C37H34F6N4O5/c38-36(39,40)33(44-51)27-15-7-13-25(17-27)21-46-29(19-23-9-3-1-4-10-23)31(48)32(49)30(20-24-11-5-2-6-12-24)47(35(46)50)22-26-14-8-16-28(18-26)34(45-52)37(41,42)43/h1-18,29-34,48-49H,19-22H2/t29-,30-,31+,32+,33?,34?/m1/s1 |
| InChIKey | WCAGFROALOKRDR-UIQKQUQUSA-N |
| XLogP | 7.81 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |