C13H18N2O3S — CID 54423811
N'-[(3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)sulfonyl]-N,N-dimethylmethanimidamide (PubChem CID 54423811) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is N'-[(3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)sulfonyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)sulfonyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 54423811 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N'-[(3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)sulfonyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NS(=O)(=O)c1cc2c(cc1O)CCCC2 |
| InChI | InChI=1S/C13H18N2O3S/c1-15(2)9-14-19(17,18)13-8-11-6-4-3-5-10(11)7-12(13)16/h7-9,16H,3-6H2,1-2H3 |
| InChIKey | WCQNBMWQYWIBNW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|