C17H25N — CID 54424054
2,4,6-tri(cyclobutyl)-2,5-dihydropyridine (PubChem CID 54424054) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 2,4,6-tri(cyclobutyl)-2,5-dihydropyridine.
| Compound Name | 2,4,6-tri(cyclobutyl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 54424054 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2,4,6-tri(cyclobutyl)-2,5-dihydropyridine |
| SMILES | C1=C(C2CCC2)CC(C2CCC2)=NC1C1CCC1 |
| InChI | InChI=1S/C17H25N/c1-4-12(5-1)15-10-16(13-6-2-7-13)18-17(11-15)14-8-3-9-14/h10,12-14,16H,1-9,11H2 |
| InChIKey | YGLGLSNBHYRWRD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|