C19H28F4O — CID 54424465
2-[4-(3,3-difluoro-4-methylcyclohexyl)cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran (PubChem CID 54424465) has the molecular formula C19H28F4O and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[4-(3,3-difluoro-4-methylcyclohexyl)cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran.
| Compound Name | 2-[4-(3,3-difluoro-4-methylcyclohexyl)cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 54424465 |
| Molecular Formula | C19H28F4O |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[4-(3,3-difluoro-4-methylcyclohexyl)cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran |
| SMILES | CC1=CCC(C2CCC(C3CCC(C)C(F)(F)C3)CC2)OC1(F)F |
| InChI | InChI=1S/C19H28F4O/c1-12-3-5-16(11-18(12,20)21)14-6-8-15(9-7-14)17-10-4-13(2)19(22,23)24-17/h4,12,14-17H,3,5-11H2,1-2H3 |
| InChIKey | WDCABFWWPKPBOB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|