C20H29ClO2 — CID 54424560
(8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-2,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 54424560) has the molecular formula C20H29ClO2 and a molecular weight of 336.90 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-2,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-2,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54424560 |
| Molecular Formula | C20H29ClO2 |
| Molecular Weight | 336.90 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-2,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@@]2(C)C(=C(Cl)C1=O)CC[C@H]1[C@@H]3CC[C@H](O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C20H29ClO2/c1-11-10-20(3)14-8-9-19(2)13(6-7-16(19)22)12(14)4-5-15(20)17(21)18(11)23/h11-14,16,22H,4-10H2,1-3H3/t11?,12-,13-,14-,16-,19-,20+/m0/s1 |
| InChIKey | WDDVMNIQUNXONR-CXEGFNPBSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|