C46H85NO7 — CID 54424817
[2-[4-[2-hydroxyethyl(methyl)amino]butanoyloxy]-3-octadec-9-enoyloxypropyl] octadec-9-enoate (PubChem CID 54424817) has the molecular formula C46H85NO7 and a molecular weight of 764.19 g/mol. Its IUPAC name is [2-[4-[2-hydroxyethyl(methyl)amino]butanoyloxy]-3-octadec-9-enoyloxypropyl] octadec-9-enoate.
| Compound Name | [2-[4-[2-hydroxyethyl(methyl)amino]butanoyloxy]-3-octadec-9-enoyloxypropyl] octadec-9-enoate |
|---|---|
| PubChem CID | 54424817 |
| Molecular Formula | C46H85NO7 |
| Molecular Weight | 764.19 g/mol |
| Exact Mass | 763.63 |
| IUPAC Name | [2-[4-[2-hydroxyethyl(methyl)amino]butanoyloxy]-3-octadec-9-enoyloxypropyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCN(C)CCO |
| InChI | InChI=1S/C46H85NO7/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-35-44(49)52-41-43(54-46(51)37-34-38-47(3)39-40-48)42-53-45(50)36-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,43,48H,4-17,22-42H2,1-3H3 |
| InChIKey | WDINNMBUVNUSFJ-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.19 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|