C19H21NO — CID 54425276
2-(1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-5-yl)phenol (PubChem CID 54425276) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-(1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-5-yl)phenol.
| Compound Name | 2-(1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-5-yl)phenol |
|---|---|
| PubChem CID | 54425276 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-(1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-5-yl)phenol |
| SMILES | CN1CCCC2C(c3ccccc3O)c3ccccc3C21 |
| InChI | InChI=1S/C19H21NO/c1-20-12-6-10-16-18(15-9-4-5-11-17(15)21)13-7-2-3-8-14(13)19(16)20/h2-5,7-9,11,16,18-19,21H,6,10,12H2,1H3 |
| InChIKey | WDQMSSSIUMIYEQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |