C17H22F2O3 — CID 54425319
5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpent-2-en-4-yn-1-ol (PubChem CID 54425319) has the molecular formula C17H22F2O3 and a molecular weight of 312.36 g/mol. Its IUPAC name is 5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpent-2-en-4-yn-1-ol.
| Compound Name | 5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpent-2-en-4-yn-1-ol |
|---|---|
| PubChem CID | 54425319 |
| Molecular Formula | C17H22F2O3 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpent-2-en-4-yn-1-ol |
| SMILES | CC(C#CC1C(C(F)F)=CC2(CC1(C)C)OCCO2)=CCO |
| InChI | InChI=1S/C17H22F2O3/c1-12(6-7-20)4-5-14-13(15(18)19)10-17(11-16(14,2)3)21-8-9-22-17/h6,10,14-15,20H,7-9,11H2,1-3H3 |
| InChIKey | WDRHIOMEHNIPPN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|