About N,N-ditert-butylbutanamide
N,N-ditert-butylbutanamide (PubChem CID 54425703) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is N,N-ditert-butylbutanamide.
Molecular Properties
| Compound Name | N,N-ditert-butylbutanamide |
| PubChem CID | 54425703 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N,N-ditert-butylbutanamide |
| SMILES | CCCC(=O)N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-8-9-10(14)13(11(2,3)4)12(5,6)7/h8-9H2,1-7H3 |
| InChIKey | OHDORAMKRGZYBL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-ditert-butylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-ditert-butylbutanamide?
The IUPAC name of N,N-ditert-butylbutanamide (CID 54425703) is N,N-ditert-butylbutanamide.
What is the SMILES notation for N,N-ditert-butylbutanamide?
The canonical SMILES for N,N-ditert-butylbutanamide is CCCC(=O)N(C(C)(C)C)C(C)(C)C.
What is the InChIKey of N,N-ditert-butylbutanamide?
The InChIKey is OHDORAMKRGZYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-8-9-10(14)13(11(2,3)4)12(5,6)7/h8-9H2,1-7H3.
What are the key properties of N,N-ditert-butylbutanamide?
N,N-ditert-butylbutanamide has a molecular weight of 199.34 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-ditert-butylbutanamide is sourced from PubChem (CID 54425703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).