C17H28O2 — CID 54426006
2-[7-[(1S)-cyclopent-2-en-1-yl]hept-4-enoxy]oxane (PubChem CID 54426006) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-[7-[(1S)-cyclopent-2-en-1-yl]hept-4-enoxy]oxane.
| Compound Name | 2-[7-[(1S)-cyclopent-2-en-1-yl]hept-4-enoxy]oxane |
|---|---|
| PubChem CID | 54426006 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-[7-[(1S)-cyclopent-2-en-1-yl]hept-4-enoxy]oxane |
| SMILES | C(=CCC[C@H]1C=CCC1)CCCOC1CCCCO1 |
| InChI | InChI=1S/C17H28O2/c1(2-4-10-16-11-5-6-12-16)3-8-14-18-17-13-7-9-15-19-17/h1-2,5,11,16-17H,3-4,6-10,12-15H2/t16-,17?/m0/s1 |
| InChIKey | WECZKZPJOMJBGI-BHWOMJMDSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|