C12H18O6 — CID 54426317
6-hydroxy-6-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoic acid (PubChem CID 54426317) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 6-hydroxy-6-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoic acid.
| Compound Name | 6-hydroxy-6-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 54426317 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 6-hydroxy-6-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoic acid |
| SMILES | CC1(C)OC(CO)C(C(O)C=CC=CC(=O)O)O1 |
| InChI | InChI=1S/C12H18O6/c1-12(2)17-9(7-13)11(18-12)8(14)5-3-4-6-10(15)16/h3-6,8-9,11,13-14H,7H2,1-2H3,(H,15,16) |
| InChIKey | WEICGPSONULCCF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|