C10H24N6 — CID 54426344
2-N-(1-aminoethyl)-1-N'-[1,2-bis(ethylideneamino)ethyl]ethane-1,1,2-triamine (PubChem CID 54426344) has the molecular formula C10H24N6 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-N-(1-aminoethyl)-1-N'-[1,2-bis(ethylideneamino)ethyl]ethane-1,1,2-triamine.
| Compound Name | 2-N-(1-aminoethyl)-1-N'-[1,2-bis(ethylideneamino)ethyl]ethane-1,1,2-triamine |
|---|---|
| PubChem CID | 54426344 |
| Molecular Formula | C10H24N6 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2-N-(1-aminoethyl)-1-N'-[1,2-bis(ethylideneamino)ethyl]ethane-1,1,2-triamine |
| SMILES | CC=NC(C/N=C/C)NC(N)CNC(C)N |
| InChI | InChI=1S/C10H24N6/c1-4-13-7-10(14-5-2)16-9(12)6-15-8(3)11/h4-5,8-10,15-16H,6-7,11-12H2,1-3H3/b13-4+,14-5? |
| InChIKey | DLRHTHWCMQITRG-GJXFESCXSA-N |
| XLogP | -0.74 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|