C26H39NO4 — CID 54426506
(2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxybutanoic acid (PubChem CID 54426506) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is (2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 54426506 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | (2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxybutanoic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C26H39NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(29)27-25(23(2)28)26(30)31/h11-23,25,28H,3-10H2,1-2H3,(H,27,29)(H,30,31)/t23-,25+/m1/s1 |
| InChIKey | WELXYFIWSBVDLY-NOZRDPDXSA-N |
| XLogP | 5.41 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|