About N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine
N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 54427498) has the molecular formula C8H12ClFN4
and a molecular weight of 218.66 g/mol. Its IUPAC name is N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 54427498 |
| Molecular Formula | C8H12ClFN4 |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)c1ncnc(F)c1Cl |
| InChI | InChI=1S/C8H12ClFN4/c1-11-3-4-14(2)8-6(9)7(10)12-5-13-8/h5,11H,3-4H2,1-2H3 |
| InChIKey | WFDLLGQWIGGASV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine (CID 54427498) is N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine is CNCCN(C)c1ncnc(F)c1Cl.
What is the InChIKey of N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine?
The InChIKey is WFDLLGQWIGGASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClFN4/c1-11-3-4-14(2)8-6(9)7(10)12-5-13-8/h5,11H,3-4H2,1-2H3.
What are the key properties of N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine?
N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine has a molecular weight of 218.66 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-6-fluoropyrimidin-4-yl)-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 54427498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).