About 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid
3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid (PubChem CID 54427614) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid |
| PubChem CID | 54427614 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(ccc3[nH]ccc32)[nH]1 |
| InChI | InChI=1S/C11H8N2O2/c14-11(15)10-5-7-6-3-4-12-8(6)1-2-9(7)13-10/h1-5,12-13H,(H,14,15) |
| InChIKey | WFFURKDWQREOMA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid?
The IUPAC name of 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid (CID 54427614) is 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid.
What is the SMILES notation for 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid?
The canonical SMILES for 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid is O=C(O)c1cc2c(ccc3[nH]ccc32)[nH]1.
What is the InChIKey of 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid?
The InChIKey is WFFURKDWQREOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c14-11(15)10-5-7-6-3-4-12-8(6)1-2-9(7)13-10/h1-5,12-13H,(H,14,15).
What are the key properties of 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid?
3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid has a molecular weight of 200.20 g/mol, XLogP of 2.35, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydropyrrolo[3,2-e]indole-2-carboxylic acid is sourced from PubChem (CID 54427614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).