C8H11Cl3O3 — CID 54427849
2,2,2-trichloroethyl 2-(oxolan-2-yl)acetate (PubChem CID 54427849) has the molecular formula C8H11Cl3O3 and a molecular weight of 261.53 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-(oxolan-2-yl)acetate.
| Compound Name | 2,2,2-trichloroethyl 2-(oxolan-2-yl)acetate |
|---|---|
| PubChem CID | 54427849 |
| Molecular Formula | C8H11Cl3O3 |
| Molecular Weight | 261.53 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 2,2,2-trichloroethyl 2-(oxolan-2-yl)acetate |
| SMILES | O=C(CC1CCCO1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H11Cl3O3/c9-8(10,11)5-14-7(12)4-6-2-1-3-13-6/h6H,1-5H2 |
| InChIKey | WFJRWUMCRXYXEB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|