C29H44N2O2 — CID 54427872
N-[4-[(8-ethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexyl]adamantane-1-carboxamide (PubChem CID 54427872) has the molecular formula C29H44N2O2 and a molecular weight of 452.68 g/mol. Its IUPAC name is N-[4-[(8-ethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[(8-ethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54427872 |
| Molecular Formula | C29H44N2O2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | N-[4-[(8-ethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexyl]adamantane-1-carboxamide |
| SMILES | CCOc1cccc2c1CC(NC(CC)CCCNC(=O)C13CC4CC(CC(C4)C1)C3)CC2 |
| InChI | InChI=1S/C29H44N2O2/c1-3-24(31-25-11-10-23-7-5-9-27(33-4-2)26(23)16-25)8-6-12-30-28(32)29-17-20-13-21(18-29)15-22(14-20)19-29/h5,7,9,20-22,24-25,31H,3-4,6,8,10-19H2,1-2H3,(H,30,32) |
| InChIKey | WFKBTGHTRCSTDB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|