C21H35NO2 — CID 54427884
N-(2-phenylethyl)-2-propoxydecanamide (PubChem CID 54427884) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-propoxydecanamide.
| Compound Name | N-(2-phenylethyl)-2-propoxydecanamide |
|---|---|
| PubChem CID | 54427884 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | N-(2-phenylethyl)-2-propoxydecanamide |
| SMILES | CCCCCCCCC(OCCC)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H35NO2/c1-3-5-6-7-8-12-15-20(24-18-4-2)21(23)22-17-16-19-13-10-9-11-14-19/h9-11,13-14,20H,3-8,12,15-18H2,1-2H3,(H,22,23) |
| InChIKey | WFKGTSRVRZYMIE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|