About 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole
5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole (PubChem CID 54428214) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole |
| PubChem CID | 54428214 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole |
| SMILES | CC(C)(C)c1ncc(-c2cnco2)s1 |
| InChI | InChI=1S/C10H12N2OS/c1-10(2,3)9-12-5-8(14-9)7-4-11-6-13-7/h4-6H,1-3H3 |
| InChIKey | YRGINHLUBZCNSB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole?
The IUPAC name of 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole (CID 54428214) is 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole.
What is the SMILES notation for 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole?
The canonical SMILES for 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole is CC(C)(C)c1ncc(-c2cnco2)s1.
What is the InChIKey of 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole?
The InChIKey is YRGINHLUBZCNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c1-10(2,3)9-12-5-8(14-9)7-4-11-6-13-7/h4-6H,1-3H3.
What are the key properties of 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole?
5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole has a molecular weight of 208.29 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-tert-butyl-1,3-thiazol-5-yl)-1,3-oxazole is sourced from PubChem (CID 54428214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).