C6H4ClF5 — CID 54428585
4-[chloro(difluoro)methyl]-5,5,5-trifluoropenta-1,3-diene (PubChem CID 54428585) has the molecular formula C6H4ClF5 and a molecular weight of 206.54 g/mol. Its IUPAC name is 4-[chloro(difluoro)methyl]-5,5,5-trifluoropenta-1,3-diene.
| Compound Name | 4-[chloro(difluoro)methyl]-5,5,5-trifluoropenta-1,3-diene |
|---|---|
| PubChem CID | 54428585 |
| Molecular Formula | C6H4ClF5 |
| Molecular Weight | 206.54 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 4-[chloro(difluoro)methyl]-5,5,5-trifluoropenta-1,3-diene |
| SMILES | C=CC=C(C(F)(F)F)C(F)(F)Cl |
| InChI | InChI=1S/C6H4ClF5/c1-2-3-4(5(7,8)9)6(10,11)12/h2-3H,1H2 |
| InChIKey | WFWYEROBRGQMTR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|