C25H32N4O4 — CID 54428886
N'-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(4-phenylphenyl)-2H-imidazol-1-yl]butanediamide (PubChem CID 54428886) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is N'-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(4-phenylphenyl)-2H-imidazol-1-yl]butanediamide.
| Compound Name | N'-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(4-phenylphenyl)-2H-imidazol-1-yl]butanediamide |
|---|---|
| PubChem CID | 54428886 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N'-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(4-phenylphenyl)-2H-imidazol-1-yl]butanediamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)C(CC(=O)NO)N1C=CN(c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H32N4O4/c1-25(2,3)22(16-30)26-24(32)21(15-23(31)27-33)29-14-13-28(17-29)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-14,21-22,30,33H,15-17H2,1-3H3,(H,26,32)(H,27,31)/t21?,22-/m1/s1 |
| InChIKey | WGBVZOVDUUTHQV-FOIFJWKZSA-N |
| XLogP | 2.69 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|