C42H79N11 — CID 54429731
1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-N,N',N"-tri(propan-2-yl)methanetriamine (PubChem CID 54429731) has the molecular formula C42H79N11 and a molecular weight of 738.17 g/mol. Its IUPAC name is 1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-N,N',N"-tri(propan-2-yl)methanetriamine.
| Compound Name | 1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-N,N',N"-tri(propan-2-yl)methanetriamine |
|---|---|
| PubChem CID | 54429731 |
| Molecular Formula | C42H79N11 |
| Molecular Weight | 738.17 g/mol |
| Exact Mass | 737.65 |
| IUPAC Name | 1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-N,N',N"-tri(propan-2-yl)methanetriamine |
| SMILES | CC(C)NC(NC(C)C)(NC(C)C)C1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C21)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C42H79N11/c1-22(2)51-42(52-23(3)4,53-24(5)6)32-21-13-20-31-33(32)41-49-39-30-19-12-11-18-29(30)37(47-39)45-35-26-15-8-7-14-25(26)34(43-35)44-36-27-16-9-10-17-28(27)38(46-36)48-40(31)50-41/h22-41,43-53H,7-21H2,1-6H3 |
| InChIKey | KLSCFBXTBJSEMY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|