About tert-butyl N-diazocarbamoperoxoate
tert-butyl N-diazocarbamoperoxoate (PubChem CID 54430086) has the molecular formula C5H9N3O3
and a molecular weight of 159.14 g/mol. Its IUPAC name is tert-butyl N-diazocarbamoperoxoate.
Molecular Properties
| Compound Name | tert-butyl N-diazocarbamoperoxoate |
| PubChem CID | 54430086 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | tert-butyl N-diazocarbamoperoxoate |
| SMILES | CC(C)(C)OOC(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C5H9N3O3/c1-5(2,3)11-10-4(9)7-8-6/h1-3H3 |
| InChIKey | WGWKOWNEGXTYTH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-diazocarbamoperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-diazocarbamoperoxoate?
The IUPAC name of tert-butyl N-diazocarbamoperoxoate (CID 54430086) is tert-butyl N-diazocarbamoperoxoate.
What is the SMILES notation for tert-butyl N-diazocarbamoperoxoate?
The canonical SMILES for tert-butyl N-diazocarbamoperoxoate is CC(C)(C)OOC(=O)N=[N+]=[N-].
What is the InChIKey of tert-butyl N-diazocarbamoperoxoate?
The InChIKey is WGWKOWNEGXTYTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O3/c1-5(2,3)11-10-4(9)7-8-6/h1-3H3.
What are the key properties of tert-butyl N-diazocarbamoperoxoate?
tert-butyl N-diazocarbamoperoxoate has a molecular weight of 159.14 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-diazocarbamoperoxoate is sourced from PubChem (CID 54430086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).