C15H19N3O6S — CID 54430410
[(5S,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 54430410) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is [(5S,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(5S,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54430410 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(5S,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC3OC(C)(C)O[C@@H]3[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C15H19N3O6S/c1-9-4-6-10(7-5-9)25(19,20)21-8-11-12(17-18-16)13-14(22-11)24-15(2,3)23-13/h4-7,11-14H,8H2,1-3H3/t11-,12+,13-,14?/m1/s1 |
| InChIKey | WHBQDLAHHOQLFF-RBKKPWLPSA-N |
| XLogP | 2.26 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|