About 4-nitro-1H-quinoxaline-2,3-dione
4-nitro-1H-quinoxaline-2,3-dione (PubChem CID 54430486) has the molecular formula C8H5N3O4
and a molecular weight of 207.15 g/mol. Its IUPAC name is 4-nitro-1H-quinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 4-nitro-1H-quinoxaline-2,3-dione |
| PubChem CID | 54430486 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 4-nitro-1H-quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccccc2n([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C8H5N3O4/c12-7-8(13)10(11(14)15)6-4-2-1-3-5(6)9-7/h1-4H,(H,9,12) |
| InChIKey | WHCRZZIBXAGFLY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-1H-quinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-1H-quinoxaline-2,3-dione?
The IUPAC name of 4-nitro-1H-quinoxaline-2,3-dione (CID 54430486) is 4-nitro-1H-quinoxaline-2,3-dione.
What is the SMILES notation for 4-nitro-1H-quinoxaline-2,3-dione?
The canonical SMILES for 4-nitro-1H-quinoxaline-2,3-dione is O=c1[nH]c2ccccc2n([N+](=O)[O-])c1=O.
What is the InChIKey of 4-nitro-1H-quinoxaline-2,3-dione?
The InChIKey is WHCRZZIBXAGFLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O4/c12-7-8(13)10(11(14)15)6-4-2-1-3-5(6)9-7/h1-4H,(H,9,12).
What are the key properties of 4-nitro-1H-quinoxaline-2,3-dione?
4-nitro-1H-quinoxaline-2,3-dione has a molecular weight of 207.15 g/mol, XLogP of -0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-1H-quinoxaline-2,3-dione is sourced from PubChem (CID 54430486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).