About 6-methyl-2-propan-2-yl-1,3-oxathiane
6-methyl-2-propan-2-yl-1,3-oxathiane (PubChem CID 544306) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is 6-methyl-2-propan-2-yl-1,3-oxathiane.
Molecular Properties
| Compound Name | 6-methyl-2-propan-2-yl-1,3-oxathiane |
| PubChem CID | 544306 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 6-methyl-2-propan-2-yl-1,3-oxathiane |
| SMILES | CC1CCSC(C(C)C)O1 |
| InChI | InChI=1S/C8H16OS/c1-6(2)8-9-7(3)4-5-10-8/h6-8H,4-5H2,1-3H3 |
| InChIKey | SIJVEYDZJVMCFI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2-propan-2-yl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propan-2-yl-1,3-oxathiane?
The IUPAC name of 6-methyl-2-propan-2-yl-1,3-oxathiane (CID 544306) is 6-methyl-2-propan-2-yl-1,3-oxathiane.
What is the SMILES notation for 6-methyl-2-propan-2-yl-1,3-oxathiane?
The canonical SMILES for 6-methyl-2-propan-2-yl-1,3-oxathiane is CC1CCSC(C(C)C)O1.
What is the InChIKey of 6-methyl-2-propan-2-yl-1,3-oxathiane?
The InChIKey is SIJVEYDZJVMCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS/c1-6(2)8-9-7(3)4-5-10-8/h6-8H,4-5H2,1-3H3.
What are the key properties of 6-methyl-2-propan-2-yl-1,3-oxathiane?
6-methyl-2-propan-2-yl-1,3-oxathiane has a molecular weight of 160.28 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propan-2-yl-1,3-oxathiane is sourced from PubChem (CID 544306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).