C5H4F4N2O7 — CID 54430717
(1,1,2,2-tetrafluoro-3,3-dinitrobutyl) hydrogen carbonate (PubChem CID 54430717) has the molecular formula C5H4F4N2O7 and a molecular weight of 280.09 g/mol. Its IUPAC name is (1,1,2,2-tetrafluoro-3,3-dinitrobutyl) hydrogen carbonate.
| Compound Name | (1,1,2,2-tetrafluoro-3,3-dinitrobutyl) hydrogen carbonate |
|---|---|
| PubChem CID | 54430717 |
| Molecular Formula | C5H4F4N2O7 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (1,1,2,2-tetrafluoro-3,3-dinitrobutyl) hydrogen carbonate |
| SMILES | CC([N+](=O)[O-])([N+](=O)[O-])C(F)(F)C(F)(F)OC(=O)O |
| InChI | InChI=1S/C5H4F4N2O7/c1-3(10(14)15,11(16)17)4(6,7)5(8,9)18-2(12)13/h1H3,(H,12,13) |
| InChIKey | WHGNEGOPGUAHCX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|