About 1,3-dioxacyclopentadecane-4,15-dione
1,3-dioxacyclopentadecane-4,15-dione (PubChem CID 54430729) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 1,3-dioxacyclopentadecane-4,15-dione.
Molecular Properties
| Compound Name | 1,3-dioxacyclopentadecane-4,15-dione |
| PubChem CID | 54430729 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1,3-dioxacyclopentadecane-4,15-dione |
| SMILES | O=C1CCCCCCCCCCC(=O)OCO1 |
| InChI | InChI=1S/C13H22O4/c14-12-9-7-5-3-1-2-4-6-8-10-13(15)17-11-16-12/h1-11H2 |
| InChIKey | WHGSAZMOVSYOCX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dioxacyclopentadecane-4,15-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxacyclopentadecane-4,15-dione?
The IUPAC name of 1,3-dioxacyclopentadecane-4,15-dione (CID 54430729) is 1,3-dioxacyclopentadecane-4,15-dione.
What is the SMILES notation for 1,3-dioxacyclopentadecane-4,15-dione?
The canonical SMILES for 1,3-dioxacyclopentadecane-4,15-dione is O=C1CCCCCCCCCCC(=O)OCO1.
What is the InChIKey of 1,3-dioxacyclopentadecane-4,15-dione?
The InChIKey is WHGSAZMOVSYOCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c14-12-9-7-5-3-1-2-4-6-8-10-13(15)17-11-16-12/h1-11H2.
What are the key properties of 1,3-dioxacyclopentadecane-4,15-dione?
1,3-dioxacyclopentadecane-4,15-dione has a molecular weight of 242.31 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxacyclopentadecane-4,15-dione is sourced from PubChem (CID 54430729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).