About 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene
1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene (PubChem CID 54431612) has the molecular formula C9H12BrCl
and a molecular weight of 235.55 g/mol. Its IUPAC name is 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene.
Molecular Properties
| Compound Name | 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene |
| PubChem CID | 54431612 |
| Molecular Formula | C9H12BrCl |
| Molecular Weight | 235.55 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene |
| SMILES | CC1=C(C=C(Cl)Br)CCC1C |
| InChI | InChI=1S/C9H12BrCl/c1-6-3-4-8(7(6)2)5-9(10)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | WHWFFWLKZYZVQK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene?
The IUPAC name of 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene (CID 54431612) is 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene.
What is the SMILES notation for 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene?
The canonical SMILES for 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene is CC1=C(C=C(Cl)Br)CCC1C.
What is the InChIKey of 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene?
The InChIKey is WHWFFWLKZYZVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrCl/c1-6-3-4-8(7(6)2)5-9(10)11/h5-6H,3-4H2,1-2H3.
What are the key properties of 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene?
1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene has a molecular weight of 235.55 g/mol, XLogP of 4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-2-chloroethenyl)-2,3-dimethylcyclopentene is sourced from PubChem (CID 54431612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).