C25H47NO2 — CID 54431727
1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one (PubChem CID 54431727) has the molecular formula C25H47NO2 and a molecular weight of 393.66 g/mol. Its IUPAC name is 1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one.
| Compound Name | 1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one |
|---|---|
| PubChem CID | 54431727 |
| Molecular Formula | C25H47NO2 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.36 |
| IUPAC Name | 1-(3-hydroxypiperidin-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one |
| SMILES | CC(=CC(=O)N1CCCC(O)C1)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H47NO2/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)18-25(28)26-17-9-16-24(27)19-26/h18,20-22,24,27H,6-17,19H2,1-5H3 |
| InChIKey | WHYCSCRWKIYGLZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|