About 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol
2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol (PubChem CID 54432012) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol.
Molecular Properties
| Compound Name | 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol |
| PubChem CID | 54432012 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCc1ccccc1)CC=CC2 |
| InChI | InChI=1S/C16H17NO2/c18-15-13-8-4-5-9-14(13)16(19)17(15)11-10-12-6-2-1-3-7-12/h1-7,18-19H,8-11H2 |
| InChIKey | WICXSBUSBXLXNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol?
The IUPAC name of 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol (CID 54432012) is 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol.
What is the SMILES notation for 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol?
The canonical SMILES for 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol is Oc1c2c(c(O)n1CCc1ccccc1)CC=CC2.
What is the InChIKey of 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol?
The InChIKey is WICXSBUSBXLXNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c18-15-13-8-4-5-9-14(13)16(19)17(15)11-10-12-6-2-1-3-7-12/h1-7,18-19H,8-11H2.
What are the key properties of 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol?
2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol has a molecular weight of 255.32 g/mol, XLogP of 2.80, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethyl)-4,7-dihydroisoindole-1,3-diol is sourced from PubChem (CID 54432012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).