C10H18O7 — CID 54432024
prop-2-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylhexanoate (PubChem CID 54432024) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is prop-2-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylhexanoate.
| Compound Name | prop-2-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylhexanoate |
|---|---|
| PubChem CID | 54432024 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | prop-2-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylhexanoate |
| SMILES | C=CCOC(=O)[C@](C)(O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H18O7/c1-3-4-17-9(15)10(2,16)8(14)7(13)6(12)5-11/h3,6-8,11-14,16H,1,4-5H2,2H3/t6-,7-,8+,10-/m1/s1 |
| InChIKey | WIDCBSUKOWRQAB-BDNRQGISSA-N |
| XLogP | -2.46 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|