About methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate
methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate (PubChem CID 54432040) has the molecular formula C17H30N2O6
and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate.
Molecular Properties
| Compound Name | methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate |
| PubChem CID | 54432040 |
| Molecular Formula | C17H30N2O6 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate |
| SMILES | C/C=C\C(=O)NC(CC)C(=O)OC.CCC(=O)NC(CC)C(=O)OC |
| InChI | InChI=1S/C9H15NO3.C8H15NO3/c1-4-6-8(11)10-7(5-2)9(12)13-3;1-4-6(8(11)12-3)9-7(10)5-2/h4,6-7H,5H2,1-3H3,(H,10,11);6H,4-5H2,1-3H3,(H,9,10)/b6-4-; |
| InChIKey | WIDJDKMUHVNOER-YHSAGPEESA-N |
| XLogP | 1.09 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate?
The IUPAC name of methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate (CID 54432040) is methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate.
What is the SMILES notation for methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate?
The canonical SMILES for methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate is C/C=C\C(=O)NC(CC)C(=O)OC.CCC(=O)NC(CC)C(=O)OC.
What is the InChIKey of methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate?
The InChIKey is WIDJDKMUHVNOER-YHSAGPEESA-N. The full InChI is InChI=1S/C9H15NO3.C8H15NO3/c1-4-6-8(11)10-7(5-2)9(12)13-3;1-4-6(8(11)12-3)9-7(10)5-2/h4,6-7H,5H2,1-3H3,(H,10,11);6H,4-5H2,1-3H3,(H,9,10)/b6-4-;.
What are the key properties of methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate?
methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate has a molecular weight of 358.44 g/mol, XLogP of 1.09, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(Z)-but-2-enoyl]amino]butanoate;methyl 2-(propanoylamino)butanoate is sourced from PubChem (CID 54432040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).