C9H10F9N — CID 54432200
1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)piperidine (PubChem CID 54432200) has the molecular formula C9H10F9N and a molecular weight of 303.17 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)piperidine.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)piperidine |
|---|---|
| PubChem CID | 54432200 |
| Molecular Formula | C9H10F9N |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)piperidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C9H10F9N/c10-6(11,8(14,15)16)7(12,13)9(17,18)19-4-2-1-3-5-19/h1-5H2 |
| InChIKey | WIGDJRPIKQBWRL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|