C23H39FO4 — CID 54432343
(2R,3S,3aS,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 54432343) has the molecular formula C23H39FO4 and a molecular weight of 398.56 g/mol. Its IUPAC name is (2R,3S,3aS,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (2R,3S,3aS,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 54432343 |
| Molecular Formula | C23H39FO4 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (2R,3S,3aS,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)(C)[C@@H](C=C[C@@H]1[C@@H]2[C@H](F)[C@H](O)O[C@H]2C[C@H]1C)OC1CCCCO1 |
| InChI | InChI=1S/C23H39FO4/c1-5-6-12-23(3,4)18(28-19-9-7-8-13-26-19)11-10-16-15(2)14-17-20(16)21(24)22(25)27-17/h10-11,15-22,25H,5-9,12-14H2,1-4H3/t15-,16+,17+,18-,19?,20+,21+,22-/m1/s1 |
| InChIKey | WIIOSFLGHLJCRT-UYYOKHNCSA-N |
| XLogP | 5.00 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|