C17H20O2S2 — CID 54432841
2-[[2-(4-methylsulfanylphenyl)thiophen-3-yl]methoxy]oxane (PubChem CID 54432841) has the molecular formula C17H20O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-[[2-(4-methylsulfanylphenyl)thiophen-3-yl]methoxy]oxane.
| Compound Name | 2-[[2-(4-methylsulfanylphenyl)thiophen-3-yl]methoxy]oxane |
|---|---|
| PubChem CID | 54432841 |
| Molecular Formula | C17H20O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[[2-(4-methylsulfanylphenyl)thiophen-3-yl]methoxy]oxane |
| SMILES | CSc1ccc(-c2sccc2COC2CCCCO2)cc1 |
| InChI | InChI=1S/C17H20O2S2/c1-20-15-7-5-13(6-8-15)17-14(9-11-21-17)12-19-16-4-2-3-10-18-16/h5-9,11,16H,2-4,10,12H2,1H3 |
| InChIKey | WISAPAAEUQTQMS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |