C11H10O7 — CID 54433235
5-methyl-1,3-dioxo-6,7-dihydro-5H-2-benzofuran-4,4-dicarboxylic acid (PubChem CID 54433235) has the molecular formula C11H10O7 and a molecular weight of 254.19 g/mol. Its IUPAC name is 5-methyl-1,3-dioxo-6,7-dihydro-5H-2-benzofuran-4,4-dicarboxylic acid.
| Compound Name | 5-methyl-1,3-dioxo-6,7-dihydro-5H-2-benzofuran-4,4-dicarboxylic acid |
|---|---|
| PubChem CID | 54433235 |
| Molecular Formula | C11H10O7 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-methyl-1,3-dioxo-6,7-dihydro-5H-2-benzofuran-4,4-dicarboxylic acid |
| SMILES | CC1CCC2=C(C(=O)OC2=O)C1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H10O7/c1-4-2-3-5-6(8(13)18-7(5)12)11(4,9(14)15)10(16)17/h4H,2-3H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | WIYWGAZLIYZXOH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|