C22H44O6 — CID 54433388
2,5,10,14,15-pentahydroxy-12,16-dimethylicosan-3-one (PubChem CID 54433388) has the molecular formula C22H44O6 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2,5,10,14,15-pentahydroxy-12,16-dimethylicosan-3-one.
| Compound Name | 2,5,10,14,15-pentahydroxy-12,16-dimethylicosan-3-one |
|---|---|
| PubChem CID | 54433388 |
| Molecular Formula | C22H44O6 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 2,5,10,14,15-pentahydroxy-12,16-dimethylicosan-3-one |
| SMILES | CCCCC(C)C(O)C(O)CC(C)CC(O)CCCCC(O)CC(=O)C(C)O |
| InChI | InChI=1S/C22H44O6/c1-5-6-9-16(3)22(28)21(27)13-15(2)12-18(24)10-7-8-11-19(25)14-20(26)17(4)23/h15-19,21-25,27-28H,5-14H2,1-4H3 |
| InChIKey | WJBRQGABURAGCY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|