C16H15NO3 — CID 54433441
4-[(E)-C-(2,4-dimethylphenyl)-N-hydroxycarbonimidoyl]benzoic acid (PubChem CID 54433441) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[(E)-C-(2,4-dimethylphenyl)-N-hydroxycarbonimidoyl]benzoic acid.
| Compound Name | 4-[(E)-C-(2,4-dimethylphenyl)-N-hydroxycarbonimidoyl]benzoic acid |
|---|---|
| PubChem CID | 54433441 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-[(E)-C-(2,4-dimethylphenyl)-N-hydroxycarbonimidoyl]benzoic acid |
| SMILES | Cc1ccc(/C(=N/O)c2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C16H15NO3/c1-10-3-8-14(11(2)9-10)15(17-20)12-4-6-13(7-5-12)16(18)19/h3-9,20H,1-2H3,(H,18,19)/b17-15+ |
| InChIKey | WJCOOBUAMMACPC-BMRADRMJSA-N |
| XLogP | 3.23 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|