cyclopent-2-ene-1,2-dicarboxylic acid

C7H8O4 — CID 54433583

IUPACcyclopent-2-ene-1,2-dicarboxylic acid
SMILESO=C(O)C1=CCCC1C(=O)O
InChIInChI=1S/C7H8O4/c8-6(9)4-2-1-3-5(4)7(10)11/h2,5H,1,3H2,(H,8,9)(H,10,11)
InChIKeyWJEWRFNEVUOSFE-UHFFFAOYSA-N
MW156.14 g/mol
LogP0.49
Rot. Bonds2

About cyclopent-2-ene-1,2-dicarboxylic acid

cyclopent-2-ene-1,2-dicarboxylic acid (PubChem CID 54433583) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is cyclopent-2-ene-1,2-dicarboxylic acid.

Molecular Properties

Compound Namecyclopent-2-ene-1,2-dicarboxylic acid
PubChem CID54433583
Molecular FormulaC7H8O4
Molecular Weight156.14 g/mol
Exact Mass156.04
IUPAC Namecyclopent-2-ene-1,2-dicarboxylic acid
SMILESO=C(O)C1=CCCC1C(=O)O
InChIInChI=1S/C7H8O4/c8-6(9)4-2-1-3-5(4)7(10)11/h2,5H,1,3H2,(H,8,9)(H,10,11)
InChIKeyWJEWRFNEVUOSFE-UHFFFAOYSA-N
XLogP0.49
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 50.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cyclopent-2-ene-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopent-2-ene-1,2-dicarboxylic acid?
The IUPAC name of cyclopent-2-ene-1,2-dicarboxylic acid (CID 54433583) is cyclopent-2-ene-1,2-dicarboxylic acid.
What is the SMILES notation for cyclopent-2-ene-1,2-dicarboxylic acid?
The canonical SMILES for cyclopent-2-ene-1,2-dicarboxylic acid is O=C(O)C1=CCCC1C(=O)O.
What is the InChIKey of cyclopent-2-ene-1,2-dicarboxylic acid?
The InChIKey is WJEWRFNEVUOSFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c8-6(9)4-2-1-3-5(4)7(10)11/h2,5H,1,3H2,(H,8,9)(H,10,11).
What are the key properties of cyclopent-2-ene-1,2-dicarboxylic acid?
cyclopent-2-ene-1,2-dicarboxylic acid has a molecular weight of 156.14 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-2-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 54433583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).