About cyclopent-2-ene-1,2-dicarboxylic acid
cyclopent-2-ene-1,2-dicarboxylic acid (PubChem CID 54433583) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is cyclopent-2-ene-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | cyclopent-2-ene-1,2-dicarboxylic acid |
| PubChem CID | 54433583 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | cyclopent-2-ene-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1=CCCC1C(=O)O |
| InChI | InChI=1S/C7H8O4/c8-6(9)4-2-1-3-5(4)7(10)11/h2,5H,1,3H2,(H,8,9)(H,10,11) |
| InChIKey | WJEWRFNEVUOSFE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopent-2-ene-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopent-2-ene-1,2-dicarboxylic acid?
The IUPAC name of cyclopent-2-ene-1,2-dicarboxylic acid (CID 54433583) is cyclopent-2-ene-1,2-dicarboxylic acid.
What is the SMILES notation for cyclopent-2-ene-1,2-dicarboxylic acid?
The canonical SMILES for cyclopent-2-ene-1,2-dicarboxylic acid is O=C(O)C1=CCCC1C(=O)O.
What is the InChIKey of cyclopent-2-ene-1,2-dicarboxylic acid?
The InChIKey is WJEWRFNEVUOSFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c8-6(9)4-2-1-3-5(4)7(10)11/h2,5H,1,3H2,(H,8,9)(H,10,11).
What are the key properties of cyclopent-2-ene-1,2-dicarboxylic acid?
cyclopent-2-ene-1,2-dicarboxylic acid has a molecular weight of 156.14 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-2-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 54433583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).