About 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene
3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene (PubChem CID 54433852) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene.
Molecular Properties
| Compound Name | 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene |
| PubChem CID | 54433852 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene |
| SMILES | CC=CC1OCC2(CC=CCC2)CO1 |
| InChI | InChI=1S/C12H18O2/c1-2-6-11-13-9-12(10-14-11)7-4-3-5-8-12/h2-4,6,11H,5,7-10H2,1H3 |
| InChIKey | WJJDWNLIVOBXKR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene?
The IUPAC name of 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene (CID 54433852) is 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene.
What is the SMILES notation for 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene?
The canonical SMILES for 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene is CC=CC1OCC2(CC=CCC2)CO1.
What is the InChIKey of 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene?
The InChIKey is WJJDWNLIVOBXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-2-6-11-13-9-12(10-14-11)7-4-3-5-8-12/h2-4,6,11H,5,7-10H2,1H3.
What are the key properties of 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene?
3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene has a molecular weight of 194.27 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-enyl-2,4-dioxaspiro[5.5]undec-9-ene is sourced from PubChem (CID 54433852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).