About 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one
4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one (PubChem CID 54434134) has the molecular formula C16H12O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one |
| PubChem CID | 54434134 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=CC=CC=C2C=CC(=O)C=C2)C=C1 |
| InChI | InChI=1S/C16H12O2/c17-15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(18)12-8-14/h1-12H |
| InChIKey | WJOFLGVDDRYEKY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one?
The IUPAC name of 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one (CID 54434134) is 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one is O=C1C=CC(=CC=CC=C2C=CC(=O)C=C2)C=C1.
What is the InChIKey of 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one?
The InChIKey is WJOFLGVDDRYEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O2/c17-15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(18)12-8-14/h1-12H.
What are the key properties of 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one?
4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one has a molecular weight of 236.27 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-oxocyclohexa-2,5-dien-1-ylidene)but-2-enylidene]cyclohexa-2,5-dien-1-one is sourced from PubChem (CID 54434134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).