C18H20N4 — CID 54434264
7-cyclohexyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 54434264) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 7-cyclohexyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-cyclohexyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 54434264 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 7-cyclohexyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(-c1ccccc1)cn2C1CCCCC1 |
| InChI | InChI=1S/C18H20N4/c19-17-16-15(13-7-3-1-4-8-13)11-22(18(16)21-12-20-17)14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H2,19,20,21) |
| InChIKey | WJQBYRAHFZAGCV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |